C14H13N5O4 — CID 23455310
(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl pyridine-2-carboxylate (PubChem CID 23455310) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl pyridine-2-carboxylate.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl pyridine-2-carboxylate |
|---|---|
| PubChem CID | 23455310 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl pyridine-2-carboxylate |
| SMILES | Cn1c(=O)c2c(ncn2COC(=O)c2ccccn2)n(C)c1=O |
| InChI | InChI=1S/C14H13N5O4/c1-17-11-10(12(20)18(2)14(17)22)19(7-16-11)8-23-13(21)9-5-3-4-6-15-9/h3-7H,8H2,1-2H3 |
| InChIKey | SCGVWXOXUSQLHI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |