C17H20N4O4 — CID 47045324
1,3-dimethyl-7-[2-(2-phenoxyethoxy)ethyl]purine-2,6-dione (PubChem CID 47045324) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(2-phenoxyethoxy)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(2-phenoxyethoxy)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 47045324 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1,3-dimethyl-7-[2-(2-phenoxyethoxy)ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCOCCOc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C17H20N4O4/c1-19-15-14(16(22)20(2)17(19)23)21(12-18-15)8-9-24-10-11-25-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | KMEGEPKMMXYBAG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|