C15H15BrN4O3 — CID 4808156
7-[2-(3-bromophenoxy)ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 4808156) has the molecular formula C15H15BrN4O3 and a molecular weight of 379.21 g/mol. Its IUPAC name is 7-[2-(3-bromophenoxy)ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(3-bromophenoxy)ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4808156 |
| Molecular Formula | C15H15BrN4O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 7-[2-(3-bromophenoxy)ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCOc2cccc(Br)c2)n(C)c1=O |
| InChI | InChI=1S/C15H15BrN4O3/c1-18-13-12(14(21)19(2)15(18)22)20(9-17-13)6-7-23-11-5-3-4-10(16)8-11/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | JSNPCYITBLKVNM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |