C9H11N5O5 — CID 21119445
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl nitrate (PubChem CID 21119445) has the molecular formula C9H11N5O5 and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl nitrate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl nitrate |
|---|---|
| PubChem CID | 21119445 |
| Molecular Formula | C9H11N5O5 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl nitrate |
| SMILES | Cn1c(=O)c2c(ncn2CCO[N+](=O)[O-])n(C)c1=O |
| InChI | InChI=1S/C9H11N5O5/c1-11-7-6(8(15)12(2)9(11)16)13(5-10-7)3-4-19-14(17)18/h5H,3-4H2,1-2H3 |
| InChIKey | GXJKYRIJFAREAM-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|