C18H26ClN5O4 — CID 110180837
1,3-dimethyl-7-[2-[2-(3-oxo-8-azabicyclo[3.2.1]octan-8-yl)ethoxy]ethyl]purine-2,6-dione;hydrochloride (PubChem CID 110180837) has the molecular formula C18H26ClN5O4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[2-(3-oxo-8-azabicyclo[3.2.1]octan-8-yl)ethoxy]ethyl]purine-2,6-dione;hydrochloride.
| Compound Name | 1,3-dimethyl-7-[2-[2-(3-oxo-8-azabicyclo[3.2.1]octan-8-yl)ethoxy]ethyl]purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 110180837 |
| Molecular Formula | C18H26ClN5O4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1,3-dimethyl-7-[2-[2-(3-oxo-8-azabicyclo[3.2.1]octan-8-yl)ethoxy]ethyl]purine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2CCOCCN2C3CCC2CC(=O)C3)n(C)c1=O |
| InChI | InChI=1S/C18H25N5O4.ClH/c1-20-16-15(17(25)21(2)18(20)26)22(11-19-16)5-7-27-8-6-23-12-3-4-13(23)10-14(24)9-12;/h11-13H,3-10H2,1-2H3;1H |
| InChIKey | OXCYISJKIRQXSF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|