C14H20N4O4 — CID 129249496
1,3-dimethyl-7-[2-(oxan-2-yloxy)ethyl]purine-2,6-dione (PubChem CID 129249496) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(oxan-2-yloxy)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(oxan-2-yloxy)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 129249496 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1,3-dimethyl-7-[2-(oxan-2-yloxy)ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCOC2CCCCO2)n(C)c1=O |
| InChI | InChI=1S/C14H20N4O4/c1-16-12-11(13(19)17(2)14(16)20)18(9-15-12)6-8-22-10-5-3-4-7-21-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | KBFUAZGXLYDXSQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |