C18H28N4O7 — CID 560178
1,3-dimethyl-7-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)purine-2,6-dione (PubChem CID 560178) has the molecular formula C18H28N4O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 1,3-dimethyl-7-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 560178 |
| Molecular Formula | C18H28N4O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1,3-dimethyl-7-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC2COCCOCCOCCOCCO2)n(C)c1=O |
| InChI | InChI=1S/C18H28N4O7/c1-20-16-15(17(23)21(2)18(20)24)22(13-19-16)11-14-12-28-8-7-26-4-3-25-5-6-27-9-10-29-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | IHSDPGJTRMOJRT-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 107.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |