C13H18N4O3 — CID 18775675
1,3-dimethyl-7-(oxan-2-ylmethyl)purine-2,6-dione (PubChem CID 18775675) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1,3-dimethyl-7-(oxan-2-ylmethyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(oxan-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 18775675 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1,3-dimethyl-7-(oxan-2-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC2CCCCO2)n(C)c1=O |
| InChI | InChI=1S/C13H18N4O3/c1-15-11-10(12(18)16(2)13(15)19)17(8-14-11)7-9-5-3-4-6-20-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | QOAZYIGVAMBDKJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |