C17H17ClN4O5 — CID 3041624
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(4-chlorophenoxy)acetate (PubChem CID 3041624) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(4-chlorophenoxy)acetate.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 3041624 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-(4-chlorophenoxy)acetate |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)COc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C17H17ClN4O5/c1-20-15-14(16(24)21(2)17(20)25)22(10-19-15)7-8-26-13(23)9-27-12-5-3-11(18)4-6-12/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | BGOGEMRVZPZNIH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |