C16H17ClN4O4 — CID 53375712
8-[2-(4-chlorophenoxy)ethoxy]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 53375712) has the molecular formula C16H17ClN4O4 and a molecular weight of 364.79 g/mol. Its IUPAC name is 8-[2-(4-chlorophenoxy)ethoxy]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-(4-chlorophenoxy)ethoxy]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 53375712 |
| Molecular Formula | C16H17ClN4O4 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 8-[2-(4-chlorophenoxy)ethoxy]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(OCCOc3ccc(Cl)cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H17ClN4O4/c1-19-12-13(20(2)16(23)21(3)14(12)22)18-15(19)25-9-8-24-11-6-4-10(17)5-7-11/h4-7H,8-9H2,1-3H3 |
| InChIKey | XPLFQPMQLCSNFG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|