C19H23ClN4O4 — CID 90403994
7-[(4-chlorophenyl)methyl]-8-(5-hydroxypentoxy)-1,3-dimethylpurine-2,6-dione (PubChem CID 90403994) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-(5-hydroxypentoxy)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-(5-hydroxypentoxy)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 90403994 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-(5-hydroxypentoxy)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(OCCCCCO)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C19H23ClN4O4/c1-22-16-15(17(26)23(2)19(22)27)24(12-13-6-8-14(20)9-7-13)18(21-16)28-11-5-3-4-10-25/h6-9,25H,3-5,10-12H2,1-2H3 |
| InChIKey | LMVRUTULUNHQOT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|