C25H31ClN4O4 — CID 130445547
7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[(2E,4Z)-3-propan-2-ylhexa-2,4-dien-2-yl]oxypurine-2,6-dione (PubChem CID 130445547) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[(2E,4Z)-3-propan-2-ylhexa-2,4-dien-2-yl]oxypurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[(2E,4Z)-3-propan-2-ylhexa-2,4-dien-2-yl]oxypurine-2,6-dione |
|---|---|
| PubChem CID | 130445547 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[(2E,4Z)-3-propan-2-ylhexa-2,4-dien-2-yl]oxypurine-2,6-dione |
| SMILES | C/C=C\C(=C(/C)Oc1nc2c(c(=O)n(CCCO)c(=O)n2C)n1Cc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C25H31ClN4O4/c1-6-8-20(16(2)3)17(4)34-24-27-22-21(30(24)15-18-9-11-19(26)12-10-18)23(32)29(13-7-14-31)25(33)28(22)5/h6,8-12,16,31H,7,13-15H2,1-5H3/b8-6-,20-17- |
| InChIKey | UFXHXZAJFCVLCP-LIWKJCBZSA-N |
| XLogP | 3.87 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|