C21H27N4O4- — CID 123831791
CID 123831791 (PubChem CID 123831791) has the molecular formula C21H27N4O4- and a molecular weight of 399.47 g/mol.
| Compound Name | CID 123831791 |
|---|---|
| PubChem CID | 123831791 |
| Molecular Formula | C21H27N4O4- |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | — |
| SMILES | [CH2-]c1ccc(Cn2c(OCCCC)nc3c2c(=O)n(CCCO)c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H27N4O4/c1-4-5-13-29-20-22-18-17(25(20)14-16-9-7-15(2)8-10-16)19(27)24(11-6-12-26)21(28)23(18)3/h7-10,26H,2,4-6,11-14H2,1,3H3/q-1 |
| InChIKey | MYLIDHYDRNGFDZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|