C20H25ClN6O4 — CID 129112851
7-[(4-chlorophenyl)methyl]-8-[2-(dimethylamino)ethoxy]-3-methyl-1-(3-nitrosopropyl)purine-2,6-dione (PubChem CID 129112851) has the molecular formula C20H25ClN6O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-[2-(dimethylamino)ethoxy]-3-methyl-1-(3-nitrosopropyl)purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-[2-(dimethylamino)ethoxy]-3-methyl-1-(3-nitrosopropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 129112851 |
| Molecular Formula | C20H25ClN6O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-[2-(dimethylamino)ethoxy]-3-methyl-1-(3-nitrosopropyl)purine-2,6-dione |
| SMILES | CN(C)CCOc1nc2c(c(=O)n(CCCN=O)c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN6O4/c1-24(2)11-12-31-19-23-17-16(27(19)13-14-5-7-15(21)8-6-14)18(28)26(10-4-9-22-30)20(29)25(17)3/h5-8H,4,9-13H2,1-3H3 |
| InChIKey | JJHLVVQJDROFRV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|