C20H25IN4O4 — CID 130445695
1-(3-hydroxypropyl)-7-[[4-(iodomethyl)phenyl]methyl]-3-methyl-8-propoxypurine-2,6-dione (PubChem CID 130445695) has the molecular formula C20H25IN4O4 and a molecular weight of 512.35 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-7-[[4-(iodomethyl)phenyl]methyl]-3-methyl-8-propoxypurine-2,6-dione.
| Compound Name | 1-(3-hydroxypropyl)-7-[[4-(iodomethyl)phenyl]methyl]-3-methyl-8-propoxypurine-2,6-dione |
|---|---|
| PubChem CID | 130445695 |
| Molecular Formula | C20H25IN4O4 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-(3-hydroxypropyl)-7-[[4-(iodomethyl)phenyl]methyl]-3-methyl-8-propoxypurine-2,6-dione |
| SMILES | CCCOc1nc2c(c(=O)n(CCCO)c(=O)n2C)n1Cc1ccc(CI)cc1 |
| InChI | InChI=1S/C20H25IN4O4/c1-3-11-29-19-22-17-16(18(27)24(9-4-10-26)20(28)23(17)2)25(19)13-15-7-5-14(12-21)6-8-15/h5-8,26H,3-4,9-13H2,1-2H3 |
| InChIKey | RRPUOQSNIRVJOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|