C21H27ClN4O4 — CID 90403103
7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-pentoxypurine-2,6-dione (PubChem CID 90403103) has the molecular formula C21H27ClN4O4 and a molecular weight of 434.92 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-pentoxypurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-pentoxypurine-2,6-dione |
|---|---|
| PubChem CID | 90403103 |
| Molecular Formula | C21H27ClN4O4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-pentoxypurine-2,6-dione |
| SMILES | CCCCCOc1nc2c(c(=O)n(CCCO)c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN4O4/c1-3-4-5-13-30-20-23-18-17(26(20)14-15-7-9-16(22)10-8-15)19(28)25(11-6-12-27)21(29)24(18)2/h7-10,27H,3-6,11-14H2,1-2H3 |
| InChIKey | WNQOETRQYRVBCH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|