C22H29ClN4O3 — CID 123505460
7-[(4-chlorophenyl)methyl]-3-ethyl-1-(3-hydroxypropyl)-8-pentylpurine-2,6-dione (PubChem CID 123505460) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-ethyl-1-(3-hydroxypropyl)-8-pentylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-ethyl-1-(3-hydroxypropyl)-8-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 123505460 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-ethyl-1-(3-hydroxypropyl)-8-pentylpurine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CCCO)c(=O)n2CC)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN4O3/c1-3-5-6-8-18-24-20-19(27(18)15-16-9-11-17(23)12-10-16)21(29)26(13-7-14-28)22(30)25(20)4-2/h9-12,28H,3-8,13-15H2,1-2H3 |
| InChIKey | FGCFYGLCXWLOEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|