C40H40N8O2 — CID 54374908
8-pentyl-1,3-bis(2-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54374908) has the molecular formula C40H40N8O2 and a molecular weight of 664.81 g/mol. Its IUPAC name is 8-pentyl-1,3-bis(2-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-pentyl-1,3-bis(2-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54374908 |
| Molecular Formula | C40H40N8O2 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 8-pentyl-1,3-bis(2-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CCc3ccccc3)c(=O)n2CCc2ccccc2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C40H40N8O2/c1-2-3-6-19-35-41-38-36(48(35)28-31-20-22-32(23-21-31)33-17-11-12-18-34(33)37-42-44-45-43-37)39(49)47(27-25-30-15-9-5-10-16-30)40(50)46(38)26-24-29-13-7-4-8-14-29/h4-5,7-18,20-23H,2-3,6,19,24-28H2,1H3,(H,42,43,44,45) |
| InChIKey | UVUUZPIYLZZQTR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|