C30H36N8O3 — CID 54113305
3-(2-methoxyethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54113305) has the molecular formula C30H36N8O3 and a molecular weight of 556.67 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 3-(2-methoxyethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54113305 |
| Molecular Formula | C30H36N8O3 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 3-(2-methoxyethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CCC)c(=O)n2CCOC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H36N8O3/c1-4-6-7-12-25-31-28-26(29(39)37(17-5-2)30(40)36(28)18-19-41-3)38(25)20-21-13-15-22(16-14-21)23-10-8-9-11-24(23)27-32-34-35-33-27/h8-11,13-16H,4-7,12,17-20H2,1-3H3,(H,32,33,34,35) |
| InChIKey | NIPJRDOGYVMUEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|