C31H36N8O3 — CID 67911507
1-(cyclopropylmethyl)-3-(1-methoxyethyl)-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 67911507) has the molecular formula C31H36N8O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(1-methoxyethyl)-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 1-(cyclopropylmethyl)-3-(1-methoxyethyl)-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 67911507 |
| Molecular Formula | C31H36N8O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(1-methoxyethyl)-8-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CC3CC3)c(=O)n2C(C)OC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H36N8O3/c1-4-5-6-11-26-32-29-27(30(40)38(19-21-12-13-21)31(41)39(29)20(2)42-3)37(26)18-22-14-16-23(17-15-22)24-9-7-8-10-25(24)28-33-35-36-34-28/h7-10,14-17,20-21H,4-6,11-13,18-19H2,1-3H3,(H,33,34,35,36) |
| InChIKey | KCVHTGSBAKGTGP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|