C31H36N8O2 — CID 54130686
3-(cyclopropylmethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54130686) has the molecular formula C31H36N8O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 3-(cyclopropylmethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54130686 |
| Molecular Formula | C31H36N8O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 3-(cyclopropylmethyl)-8-pentyl-1-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CCC)c(=O)n2CC2CC2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H36N8O2/c1-3-5-6-11-26-32-29-27(30(40)37(18-4-2)31(41)39(29)20-21-12-13-21)38(26)19-22-14-16-23(17-15-22)24-9-7-8-10-25(24)28-33-35-36-34-28/h7-10,14-17,21H,3-6,11-13,18-20H2,1-2H3,(H,33,34,35,36) |
| InChIKey | NUDMHYKRHNLYHM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|