C35H38N8O2 — CID 54399430
8-pentyl-1-(2-phenylethyl)-3-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54399430) has the molecular formula C35H38N8O2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 8-pentyl-1-(2-phenylethyl)-3-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-pentyl-1-(2-phenylethyl)-3-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54399430 |
| Molecular Formula | C35H38N8O2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 8-pentyl-1-(2-phenylethyl)-3-propyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CCc3ccccc3)c(=O)n2CCC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C35H38N8O2/c1-3-5-7-16-30-36-33-31(34(44)42(35(45)41(33)22-4-2)23-21-25-12-8-6-9-13-25)43(30)24-26-17-19-27(20-18-26)28-14-10-11-15-29(28)32-37-39-40-38-32/h6,8-15,17-20H,3-5,7,16,21-24H2,1-2H3,(H,37,38,39,40) |
| InChIKey | VMIXFPSXMJWJDA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|