C36H38N8O2 — CID 67911564
1-(cyclopropylmethyl)-8-pentyl-3-(1-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 67911564) has the molecular formula C36H38N8O2 and a molecular weight of 614.75 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-8-pentyl-3-(1-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 1-(cyclopropylmethyl)-8-pentyl-3-(1-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 67911564 |
| Molecular Formula | C36H38N8O2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 1-(cyclopropylmethyl)-8-pentyl-3-(1-phenylethyl)-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)n(CC3CC3)c(=O)n2C(C)c2ccccc2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C36H38N8O2/c1-3-4-6-15-31-37-34-32(35(45)43(23-25-16-17-25)36(46)44(34)24(2)27-11-7-5-8-12-27)42(31)22-26-18-20-28(21-19-26)29-13-9-10-14-30(29)33-38-40-41-39-33/h5,7-14,18-21,24-25H,3-4,6,15-17,22-23H2,1-2H3,(H,38,39,40,41) |
| InChIKey | GMEDZFHIYZOXGL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|