C24H22ClF3N4O6 — CID 90403205
7-[(4-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-methyl-8-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 90403205) has the molecular formula C24H22ClF3N4O6 and a molecular weight of 554.91 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-methyl-8-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-methyl-8-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90403205 |
| Molecular Formula | C24H22ClF3N4O6 |
| Molecular Weight | 554.91 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(2-hydroxyethyl)-3-methyl-8-[2-[2-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCO)c(=O)c2c1nc(OCCOc1ccccc1OC(F)(F)F)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClF3N4O6/c1-30-20-19(21(34)31(10-11-33)23(30)35)32(14-15-6-8-16(25)9-7-15)22(29-20)37-13-12-36-17-4-2-3-5-18(17)38-24(26,27)28/h2-9,33H,10-14H2,1H3 |
| InChIKey | BDTHMLNHGHUNPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|