C25H24ClF3N4O5 — CID 90402813
7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 90402813) has the molecular formula C25H24ClF3N4O5 and a molecular weight of 552.94 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90402813 |
| Molecular Formula | C25H24ClF3N4O5 |
| Molecular Weight | 552.94 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(OCCOc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C25H24ClF3N4O5/c1-3-11-32-22(34)20-21(31(2)24(32)35)30-23(33(20)15-16-7-9-17(26)10-8-16)37-13-12-36-18-5-4-6-19(14-18)38-25(27,28)29/h4-10,14H,3,11-13,15H2,1-2H3 |
| InChIKey | QSSLJXSKGXPLMW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.94 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|