C26H27F3N4O6 — CID 162593363
1-(3-hydroxypropyl)-3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione (PubChem CID 162593363) has the molecular formula C26H27F3N4O6 and a molecular weight of 548.52 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione.
| Compound Name | 1-(3-hydroxypropyl)-3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 162593363 |
| Molecular Formula | C26H27F3N4O6 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]purine-2,6-dione |
| SMILES | Cc1ccc(Cn2c(OCCOc3cccc(OC(F)(F)F)c3)nc3c2c(=O)n(CCCO)c(=O)n3C)cc1 |
| InChI | InChI=1S/C26H27F3N4O6/c1-17-7-9-18(10-8-17)16-33-21-22(31(2)25(36)32(23(21)35)11-4-12-34)30-24(33)38-14-13-37-19-5-3-6-20(15-19)39-26(27,28)29/h3,5-10,15,34H,4,11-14,16H2,1-2H3 |
| InChIKey | OWKNUEHNKMKLBS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|