C24H22ClF3N4O5 — CID 90403115
7-[(4-chlorophenyl)methyl]-1-(4-hydroxybutyl)-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione (PubChem CID 90403115) has the molecular formula C24H22ClF3N4O5 and a molecular weight of 538.91 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(4-hydroxybutyl)-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(4-hydroxybutyl)-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 90403115 |
| Molecular Formula | C24H22ClF3N4O5 |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(4-hydroxybutyl)-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCCO)c(=O)c2c1nc(Oc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClF3N4O5/c1-30-20-19(21(34)31(23(30)35)11-2-3-12-33)32(14-15-7-9-16(25)10-8-15)22(29-20)36-17-5-4-6-18(13-17)37-24(26,27)28/h4-10,13,33H,2-3,11-12,14H2,1H3 |
| InChIKey | VXKYLUJHRPDBOQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|