C26H26ClF3N4O4 — CID 130445457
7-[(4-chlorophenyl)methyl]-1-(5-hydroxypentyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methyl]purine-2,6-dione (PubChem CID 130445457) has the molecular formula C26H26ClF3N4O4 and a molecular weight of 550.97 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(5-hydroxypentyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(5-hydroxypentyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 130445457 |
| Molecular Formula | C26H26ClF3N4O4 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(5-hydroxypentyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCCCO)c(=O)c2c1nc(Cc1cccc(OC(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26ClF3N4O4/c1-32-23-22(24(36)33(25(32)37)12-3-2-4-13-35)34(16-17-8-10-19(27)11-9-17)21(31-23)15-18-6-5-7-20(14-18)38-26(28,29)30/h5-11,14,35H,2-4,12-13,15-16H2,1H3 |
| InChIKey | AWHKIJXZKNLTSR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|