C21H22ClIN5O4PS — CID 139452317
7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3-methyl-8-[(5-methyl-1,3-thiazol-2-yl)methoxy]purine-2,6-dione (PubChem CID 139452317) has the molecular formula C21H22ClIN5O4PS and a molecular weight of 633.84 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3-methyl-8-[(5-methyl-1,3-thiazol-2-yl)methoxy]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3-methyl-8-[(5-methyl-1,3-thiazol-2-yl)methoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 139452317 |
| Molecular Formula | C21H22ClIN5O4PS |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 632.99 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3-methyl-8-[(5-methyl-1,3-thiazol-2-yl)methoxy]purine-2,6-dione |
| SMILES | Cc1cnc(COc2nc3c(c(=O)n(CCCOPI)c(=O)n3C)n2Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H22ClIN5O4PS/c1-13-10-24-16(34-13)12-31-20-25-18-17(28(20)11-14-4-6-15(22)7-5-14)19(29)27(21(30)26(18)2)8-3-9-32-33-23/h4-7,10,33H,3,8-9,11-12H2,1-2H3 |
| InChIKey | QYNMTSDGMKADCW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|