C29H38ClF3IN4O4P — CID 144762218
7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3,8-dimethylpurine-2,6-dione;ethane;3-propan-2-yl-1-(trifluoromethoxy)cyclohexa-1,3-diene (PubChem CID 144762218) has the molecular formula C29H38ClF3IN4O4P and a molecular weight of 756.97 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3,8-dimethylpurine-2,6-dione;ethane;3-propan-2-yl-1-(trifluoromethoxy)cyclohexa-1,3-diene.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3,8-dimethylpurine-2,6-dione;ethane;3-propan-2-yl-1-(trifluoromethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144762218 |
| Molecular Formula | C29H38ClF3IN4O4P |
| Molecular Weight | 756.97 g/mol |
| Exact Mass | 756.13 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-iodophosphanyloxypropyl)-3,8-dimethylpurine-2,6-dione;ethane;3-propan-2-yl-1-(trifluoromethoxy)cyclohexa-1,3-diene |
| SMILES | CC.CC(C)C1=CCCC(OC(F)(F)F)=C1.Cc1nc2c(c(=O)n(CCCOPI)c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClIN4O3P.C10H13F3O.C2H6/c1-11-20-15-14(23(11)10-12-4-6-13(18)7-5-12)16(24)22(17(25)21(15)2)8-3-9-26-27-19;1-7(2)8-4-3-5-9(6-8)14-10(11,12)13;1-2/h4-7,27H,3,8-10H2,1-2H3;4,6-7H,3,5H2,1-2H3;1-2H3 |
| InChIKey | MSGXWSFVLIRUDY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.97 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|