C26H29F3N6O5 — CID 130445389
1-(3-aminooxypropyl)-7-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione (PubChem CID 130445389) has the molecular formula C26H29F3N6O5 and a molecular weight of 562.55 g/mol. Its IUPAC name is 1-(3-aminooxypropyl)-7-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione.
| Compound Name | 1-(3-aminooxypropyl)-7-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 130445389 |
| Molecular Formula | C26H29F3N6O5 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 1-(3-aminooxypropyl)-7-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione |
| SMILES | CN(C)Cc1ccc(Cn2c(Oc3cccc(OC(F)(F)F)c3)nc3c2c(=O)n(CCCON)c(=O)n3C)cc1 |
| InChI | InChI=1S/C26H29F3N6O5/c1-32(2)15-17-8-10-18(11-9-17)16-35-21-22(33(3)25(37)34(23(21)36)12-5-13-38-30)31-24(35)39-19-6-4-7-20(14-19)40-26(27,28)29/h4,6-11,14H,5,12-13,15-16,30H2,1-3H3 |
| InChIKey | QBDWIPPAASXVDJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|