C26H29ClN4O4 — CID 90441014
7-[(4-chlorophenyl)methyl]-3-methyl-8-[(3-methylphenyl)methoxy]-1-(2-propoxyethyl)purine-2,6-dione (PubChem CID 90441014) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(3-methylphenyl)methoxy]-1-(2-propoxyethyl)purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(3-methylphenyl)methoxy]-1-(2-propoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90441014 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-[(3-methylphenyl)methoxy]-1-(2-propoxyethyl)purine-2,6-dione |
| SMILES | CCCOCCn1c(=O)c2c(nc(OCc3cccc(C)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C26H29ClN4O4/c1-4-13-34-14-12-30-24(32)22-23(29(3)26(30)33)28-25(35-17-20-7-5-6-18(2)15-20)31(22)16-19-8-10-21(27)11-9-19/h5-11,15H,4,12-14,16-17H2,1-3H3 |
| InChIKey | JNWRPEPLDTYSDD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|