C18H19F3N4O5 — CID 172772688
1,3,7-trimethyl-8-[3-[4-(trifluoromethoxy)phenoxy]propoxy]purine-2,6-dione (PubChem CID 172772688) has the molecular formula C18H19F3N4O5 and a molecular weight of 428.37 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[3-[4-(trifluoromethoxy)phenoxy]propoxy]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[3-[4-(trifluoromethoxy)phenoxy]propoxy]purine-2,6-dione |
|---|---|
| PubChem CID | 172772688 |
| Molecular Formula | C18H19F3N4O5 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1,3,7-trimethyl-8-[3-[4-(trifluoromethoxy)phenoxy]propoxy]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(OCCCOc3ccc(OC(F)(F)F)cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C18H19F3N4O5/c1-23-13-14(24(2)17(27)25(3)15(13)26)22-16(23)29-10-4-9-28-11-5-7-12(8-6-11)30-18(19,20)21/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | NEEZXKAYUREILU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|