C16H13F3N4O4 — CID 162570462
1,3,7-trimethyl-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione (PubChem CID 162570462) has the molecular formula C16H13F3N4O4 and a molecular weight of 382.30 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
|---|---|
| PubChem CID | 162570462 |
| Molecular Formula | C16H13F3N4O4 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1,3,7-trimethyl-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(C(=O)c3cccc(OC(F)(F)F)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H13F3N4O4/c1-21-10-12(22(2)15(26)23(3)14(10)25)20-13(21)11(24)8-5-4-6-9(7-8)27-16(17,18)19/h4-7H,1-3H3 |
| InChIKey | HVRDIKNYSNFYGE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |