C15H11F3N4O4 — CID 162567463
1,3-dimethyl-8-[3-(trifluoromethoxy)benzoyl]-7H-purine-2,6-dione (PubChem CID 162567463) has the molecular formula C15H11F3N4O4 and a molecular weight of 368.27 g/mol. Its IUPAC name is 1,3-dimethyl-8-[3-(trifluoromethoxy)benzoyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[3-(trifluoromethoxy)benzoyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 162567463 |
| Molecular Formula | C15H11F3N4O4 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1,3-dimethyl-8-[3-(trifluoromethoxy)benzoyl]-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C(=O)c3cccc(OC(F)(F)F)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H11F3N4O4/c1-21-12-9(13(24)22(2)14(21)25)19-11(20-12)10(23)7-4-3-5-8(6-7)26-15(16,17)18/h3-6H,1-2H3,(H,19,20) |
| InChIKey | VXFAXOKOFVUGNY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |