C22H22ClF3N4O6 — CID 148962319
7-chloro-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione (PubChem CID 148962319) has the molecular formula C22H22ClF3N4O6 and a molecular weight of 530.89 g/mol. Its IUPAC name is 7-chloro-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione.
| Compound Name | 7-chloro-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
|---|---|
| PubChem CID | 148962319 |
| Molecular Formula | C22H22ClF3N4O6 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 7-chloro-3-methyl-1-[3-(oxan-2-yloxy)propyl]-8-[3-(trifluoromethoxy)benzoyl]purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(C(=O)c1cccc(OC(F)(F)F)c1)n2Cl |
| InChI | InChI=1S/C22H22ClF3N4O6/c1-28-18-16(20(32)29(21(28)33)9-5-11-35-15-8-2-3-10-34-15)30(23)19(27-18)17(31)13-6-4-7-14(12-13)36-22(24,25)26/h4,6-7,12,15H,2-3,5,8-11H2,1H3 |
| InChIKey | PSBGEPMKCMPIQB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|