C22H27ClN4O4S — CID 90402718
7-[(4-chlorophenyl)methyl]-3-methyl-8-methylsulfanyl-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione (PubChem CID 90402718) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-8-methylsulfanyl-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-methylsulfanyl-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 90402718 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-8-methylsulfanyl-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
| SMILES | CSc1nc2c(c(=O)n(CCCOC3CCCCO3)c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-25-19-18(27(21(24-19)32-2)14-15-7-9-16(23)10-8-15)20(28)26(22(25)29)11-5-13-31-17-6-3-4-12-30-17/h7-10,17H,3-6,11-14H2,1-2H3 |
| InChIKey | PIEOCNVNKLQFLR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|