C15H21N5O6 — CID 10067525
3,7-dimethyl-8-nitro-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione (PubChem CID 10067525) has the molecular formula C15H21N5O6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 3,7-dimethyl-8-nitro-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-nitro-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 10067525 |
| Molecular Formula | C15H21N5O6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3,7-dimethyl-8-nitro-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
| SMILES | Cn1c([N+](=O)[O-])nc2c1c(=O)n(CCCOC1CCCCO1)c(=O)n2C |
| InChI | InChI=1S/C15H21N5O6/c1-17-11-12(16-14(17)20(23)24)18(2)15(22)19(13(11)21)7-5-9-26-10-6-3-4-8-25-10/h10H,3-9H2,1-2H3 |
| InChIKey | RXTBEWVUWUXWCV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 123.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|