C12H15N5O6 — CID 10064874
3-(3,7-dimethyl-8-nitro-2,6-dioxopurin-1-yl)propyl acetate (PubChem CID 10064874) has the molecular formula C12H15N5O6 and a molecular weight of 325.28 g/mol. Its IUPAC name is 3-(3,7-dimethyl-8-nitro-2,6-dioxopurin-1-yl)propyl acetate.
| Compound Name | 3-(3,7-dimethyl-8-nitro-2,6-dioxopurin-1-yl)propyl acetate |
|---|---|
| PubChem CID | 10064874 |
| Molecular Formula | C12H15N5O6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(3,7-dimethyl-8-nitro-2,6-dioxopurin-1-yl)propyl acetate |
| SMILES | CC(=O)OCCCn1c(=O)c2c(nc([N+](=O)[O-])n2C)n(C)c1=O |
| InChI | InChI=1S/C12H15N5O6/c1-7(18)23-6-4-5-16-10(19)8-9(15(3)12(16)20)13-11(14(8)2)17(21)22/h4-6H2,1-3H3 |
| InChIKey | WYJTYNZWECVEMU-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 131.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|