C17H26N4O4 — CID 155689674
8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl acetate (PubChem CID 155689674) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl acetate.
| Compound Name | 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl acetate |
|---|---|
| PubChem CID | 155689674 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl acetate |
| SMILES | CC(=O)OCCCCCCCCn1c(C)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H26N4O4/c1-12-18-15-14(16(23)19-17(24)20(15)3)21(12)10-8-6-4-5-7-9-11-25-13(2)22/h4-11H2,1-3H3,(H,19,23,24) |
| InChIKey | JGXUGOQQWQOEFS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|