C16H19N3O6 — CID 146020984
ethyl 6-(3-acetyloxypropyl)-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylate (PubChem CID 146020984) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is ethyl 6-(3-acetyloxypropyl)-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | ethyl 6-(3-acetyloxypropyl)-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 146020984 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 6-(3-acetyloxypropyl)-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)c1nc2c(cc1CCCOC(C)=O)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H19N3O6/c1-4-24-15(22)12-10(6-5-7-25-9(2)20)8-11-13(17-12)19(3)16(23)18-14(11)21/h8H,4-7H2,1-3H3,(H,18,21,23) |
| InChIKey | MXOPLEVWQJJMAZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|