About ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate
ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate (PubChem CID 10584131) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate.
Analyze ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate?
The IUPAC name of ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate (CID 10584131) is ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate.
What is the SMILES notation for ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate?
The canonical SMILES for ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate is CCOC(=O)c1nc(=O)n(C)c(=O)[nH]1.
What is the InChIKey of ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate?
The InChIKey is OKJNCPYZGMIJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c1-3-14-5(11)4-8-6(12)10(2)7(13)9-4/h3H2,1-2H3,(H,8,9,12,13).
What are the key properties of ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate?
ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate has a molecular weight of 199.17 g/mol, XLogP of -1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-4,6-dioxo-1H-1,3,5-triazine-2-carboxylate is sourced from PubChem (CID 10584131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).