C8H10N2O4 — CID 130005141
ethyl 3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 130005141) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is ethyl 3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 130005141 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | ethyl 3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10N2O4/c1-3-14-7(12)5-4-6(11)10(2)8(13)9-5/h4H,3H2,1-2H3,(H,9,13) |
| InChIKey | RGPHOWUWSWZTSK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |