C9H11NO4 — CID 119084800
ethyl 6-(hydroxymethyl)-4-oxo-1H-pyridine-2-carboxylate (PubChem CID 119084800) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl 6-(hydroxymethyl)-4-oxo-1H-pyridine-2-carboxylate.
| Compound Name | ethyl 6-(hydroxymethyl)-4-oxo-1H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 119084800 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | ethyl 6-(hydroxymethyl)-4-oxo-1H-pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)cc(CO)[nH]1 |
| InChI | InChI=1S/C9H11NO4/c1-2-14-9(13)8-4-7(12)3-6(5-11)10-8/h3-4,11H,2,5H2,1H3,(H,10,12) |
| InChIKey | NAYFGXJUEYFQMY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |