C11H13NO5 — CID 45379992
diethyl 5-(oxo(113C)methyl)-(4,5-13C2,115N)1H-pyrrole-2,4-dicarboxylate (PubChem CID 45379992) has the molecular formula C11H13NO5 and a molecular weight of 244.19 g/mol. Its IUPAC name is diethyl 5-(oxo(113C)methyl)-(4,5-13C2,115N)1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-(oxo(113C)methyl)-(4,5-13C2,115N)1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 45379992 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | diethyl 5-(oxo(113C)methyl)-(4,5-13C2,115N)1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c[13c]([13C](=O)OCC)[13c]([13CH]=O)[15nH]1 |
| InChI | InChI=1S/C11H13NO5/c1-3-16-10(14)7-5-8(11(15)17-4-2)12-9(7)6-13/h5-6,12H,3-4H2,1-2H3/i6+1,7+1,9+1,10+1,12+1 |
| InChIKey | PPDIXFDRJOZUAD-GSZGFETFSA-N |
| XLogP | 1.18 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|