C16H16N2O4 — CID 12575837
diethyl 1,7-dihydropyrrolo[3,2-f]indole-2,6-dicarboxylate (PubChem CID 12575837) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is diethyl 1,7-dihydropyrrolo[3,2-f]indole-2,6-dicarboxylate.
| Compound Name | diethyl 1,7-dihydropyrrolo[3,2-f]indole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 12575837 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | diethyl 1,7-dihydropyrrolo[3,2-f]indole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cc3cc(C(=O)OCC)[nH]c3cc2[nH]1 |
| InChI | InChI=1S/C16H16N2O4/c1-3-21-15(19)13-6-9-5-10-7-14(16(20)22-4-2)18-12(10)8-11(9)17-13/h5-8,17-18H,3-4H2,1-2H3 |
| InChIKey | WORWAZOXJHDDAF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |