C12H17NO4 — CID 121015696
diethyl 5-ethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 121015696) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is diethyl 5-ethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-ethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 121015696 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | diethyl 5-ethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(CC)[nH]1 |
| InChI | InChI=1S/C12H17NO4/c1-4-9-8(11(14)16-5-2)7-10(13-9)12(15)17-6-3/h7,13H,4-6H2,1-3H3 |
| InChIKey | VWPVRNBDXKSXQA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |