C10H10Cl3NO3 — CID 45378502
ethyl 2-(113C)methyl-5-(2,2,2-trichloroacetyl)-(2,3-13C2,115N)1H-pyrrole-3-carboxylate (PubChem CID 45378502) has the molecular formula C10H10Cl3NO3 and a molecular weight of 303.52 g/mol. Its IUPAC name is ethyl 2-(113C)methyl-5-(2,2,2-trichloroacetyl)-(2,3-13C2,115N)1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-(113C)methyl-5-(2,2,2-trichloroacetyl)-(2,3-13C2,115N)1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 45378502 |
| Molecular Formula | C10H10Cl3NO3 |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | ethyl 2-(113C)methyl-5-(2,2,2-trichloroacetyl)-(2,3-13C2,115N)1H-pyrrole-3-carboxylate |
| SMILES | CCO[13C](=O)[13c]1cc(C(=O)C(Cl)(Cl)Cl)[15nH][13c]1[13CH3] |
| InChI | InChI=1S/C10H10Cl3NO3/c1-3-17-9(16)6-4-7(14-5(6)2)8(15)10(11,12)13/h4,14H,3H2,1-2H3/i2+1,5+1,6+1,9+1,14+1 |
| InChIKey | PHNMYDJNPASESD-JLZAESTESA-N |
| XLogP | 3.05 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|