C12H15NO5 — CID 754450
diethyl 2-methyl-6-oxo-1H-pyridine-3,5-dicarboxylate (PubChem CID 754450) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is diethyl 2-methyl-6-oxo-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-methyl-6-oxo-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 754450 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | diethyl 2-methyl-6-oxo-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c(=O)[nH]c1C |
| InChI | InChI=1S/C12H15NO5/c1-4-17-11(15)8-6-9(12(16)18-5-2)10(14)13-7(8)3/h6H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | FXDLBWVSYYXICK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |