C15H15NO5 — CID 6501538
diethyl 2-oxo-1H-quinoline-3,8-dicarboxylate (PubChem CID 6501538) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is diethyl 2-oxo-1H-quinoline-3,8-dicarboxylate.
| Compound Name | diethyl 2-oxo-1H-quinoline-3,8-dicarboxylate |
|---|---|
| PubChem CID | 6501538 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | diethyl 2-oxo-1H-quinoline-3,8-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cccc(C(=O)OCC)c2[nH]c1=O |
| InChI | InChI=1S/C15H15NO5/c1-3-20-14(18)10-7-5-6-9-8-11(15(19)21-4-2)13(17)16-12(9)10/h5-8H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | WWORZKGMVBAITL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |